CAS 58749-47-6
:5-hydroxy-4-methoxy-2-nitrobenzaldehyde
Description:
5-Hydroxy-4-methoxy-2-nitrobenzaldehyde, with the CAS number 58749-47-6, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a hydroxyl (-OH) group and a methoxy (-OCH3) group, as well as a nitro (-NO2) group, all of which are attached to a benzene ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including organic synthesis and pharmaceuticals. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the nitro group can serve as an electron-withdrawing substituent, influencing the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the methoxy group can provide electron-donating effects, which can stabilize certain reaction intermediates. Overall, the unique combination of functional groups in 5-hydroxy-4-methoxy-2-nitrobenzaldehyde makes it a versatile compound for further chemical transformations and research applications.
Formula:C8H7NO5
InChI:InChI=1/C8H7NO5/c1-14-8-3-6(9(12)13)5(4-10)2-7(8)11/h2-4,11H,1H3
SMILES:COc1cc(c(cc1O)C=O)N(=O)=O
Synonyms:- Benzaldehyde, 5-hydroxy-4-methoxy-2-nitro-
- 5-Hydroxy-4-methoxy-2-nitro-benzaldehyde
- 5-Hydroxy-4-methoxy-2-nitrobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Hydroxy-4-methoxy-2-nitro-benzaldehyde
CAS:Formula:C8H7NO5Purity:97%Color and Shape:SolidMolecular weight:197.14495-Hydroxy-4-methoxy-2-nitro-benzaldehyde
CAS:Formula:C8H7NO5Purity:97%Color and Shape:SolidMolecular weight:197.1465-Hydroxy-4-methoxy-2-nitrobenzaldehyde
CAS:5-Hydroxy-4-methoxy-2-nitrobenzaldehyde is a substrate molecule that can be minimised to the corresponding oxime, which can then be oxidised to form an aldehyde. The product of this reaction is a conformationally restricted dienone. This compound has been synthesized using a number of different methods, including oxidation by sodium dichromate. 5-Hydroxy-4-methoxy-2-nitrobenzaldehyde is a phenolic compound with two aromatic rings and one carbon ring. It has natural product properties and is used as a chemical skeleton in the synthesis of other compounds.
Formula:C8H7NO5Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:197.14 g/mol



