
CAS 5875-35-4
:γ-Glu-Ser
Description:
γ-Glu-Ser, also known as gamma-glutamylserine, is a dipeptide composed of the amino acids glutamic acid and serine. It is characterized by the presence of a gamma linkage between the carboxyl group of glutamic acid and the amino group of serine, which distinguishes it from other peptide forms. This compound plays a role in various biochemical processes, including protein synthesis and metabolism. γ-Glu-Ser is soluble in water, reflecting the polar nature of its constituent amino acids, and it can participate in various biochemical reactions due to the functional groups present in its structure. Additionally, it may serve as a substrate or intermediate in metabolic pathways, particularly in the synthesis of other biologically relevant molecules. Its CAS number, 5875-35-4, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, γ-Glu-Ser is significant in both physiological and biochemical contexts, contributing to the complexity of amino acid interactions in biological systems.
Formula:C8H14N2O6
InChI:InChI=1S/C8H14N2O6/c9-4(7(13)14)1-2-6(12)10-5(3-11)8(15)16/h4-5,11H,1-3,9H2,(H,10,12)(H,13,14)(H,15,16)/t4-,5-/m0/s1
InChI key:InChIKey=SQBNIUOYNOKDTI-WHFBIAKZSA-N
SMILES:[C@@H](NC(CC[C@@H](C(O)=O)N)=O)(C(O)=O)CO
Synonyms:- L-Serine, L-γ-glutamyl-
- L-γ-Glutamyl-L-serine
- Glutamine, N-(1-carboxy-2-hydroxyethyl)-, L-
- γ-Glutamylserine
- L-Serine, N-L-γ-glutamyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
G-Glu-Ser
CAS:G-Glu-Ser is a calcium receptor activator and Flavor-enriching agent.Formula:C8H14N2O6Color and Shape:SolidMolecular weight:234.21γ-Glu-Ser
CAS:γ-Glu-Ser is a peptide that belongs to the group of activators. It is an inhibitor of ion channels and receptors, which are proteins that bind to ligands or drugs. γ-Glu-Ser has been shown to inhibit the activity of the NMDA receptor in rat brain synaptosomes. The binding site for γ-Glu-Ser was identified as a region on the NR2B subunit. This inhibition may be due to the inhibition of calcium influx through NMDA receptor channels.
Formula:C8H14N2O6Purity:Min. 95%Molecular weight:234.21 g/molRef: 3D-FAA87535
Discontinued product

