CAS 58751-56-7
:5-Hexenyltrimethoxysilane
Description:
5-Hexenyltrimethoxysilane, with the CAS number 58751-56-7, is an organosilane compound characterized by its functional groups that include a hexenyl chain and three methoxy groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in forming siloxane bonds with various substrates, which makes it valuable in surface modification and adhesion applications. The presence of the hexenyl group provides the potential for further chemical reactions, such as polymerization or cross-linking, enhancing its utility in creating hybrid materials. Additionally, the methoxy groups can hydrolyze in the presence of moisture, leading to the formation of silanol groups that can bond with siliceous surfaces. This property is particularly advantageous in coatings, sealants, and adhesives, where improved adhesion and durability are desired. Overall, 5-Hexenyltrimethoxysilane is a versatile compound used in various industrial applications, particularly in the fields of materials science and surface chemistry.
Formula:C9H20O3Si
InChI:InChI=1S/C9H20O3Si/c1-5-6-7-8-9-13(10-2,11-3)12-4/h5H,1,6-9H2,2-4H3
InChI key:InChIKey=CGQIJXYITMTOBI-UHFFFAOYSA-N
SMILES:[Si](CCCCC=C)(OC)(OC)OC
Synonyms:- 5-Hexen-1-yltrimethoxysilane
- 6-Trimethoxysilyl-1-hexene
- Dc 2-7305Int
- Hex-5-En-1-Yl(Trimethoxy)Silane
- Kbm 1063
- Silane, 5-hexen-1-yltrimethoxy-
- Silane, 5-hexenyltrimethoxy-
- 5-Hexenyltrimethoxysilane
- Hex-5-en-1-yltrimethoxysilane
- Einecs 261-419-4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Hexenyltrimethoxysilane
CAS:Formula:C9H20O3SiPurity:97%Color and Shape:LiquidMolecular weight:204.3388Hex-5-en-1-yltrimethoxysilane
CAS:Hex-5-en-1-yltrimethoxysilanePurity:97%Molecular weight:204.34g/mol5-HEXENYLTRIMETHOXYSILANE, tech
CAS:<p>Olefin Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>5-Hexenyltrimethoxysilane; Trimethoxysilylhexene<br>Adhesion promoter for Pt-cure siliconesUsed in microparticle surface modification<br></p>Formula:C9H20O3SiPurity:techColor and Shape:Straw LiquidMolecular weight:204.345-Hexenyltrimethoxysilane, 95%
CAS:Formula:C9H20O3SiPurity:97%Color and Shape:LiquidMolecular weight:204.341



