CymitQuimica logo

CAS 58754-95-3

:

Benzenesulfonamide, N-(2,2-dimethoxyethyl)-4-methyl-

Description:
Benzenesulfonamide, N-(2,2-dimethoxyethyl)-4-methyl- is an organic compound characterized by its sulfonamide functional group, which is a sulfonic acid derivative containing an amine. This compound features a benzene ring substituted with a methyl group at the para position and a 2,2-dimethoxyethyl group attached to the nitrogen atom of the sulfonamide. The presence of the dimethoxyethyl group contributes to its solubility and potential reactivity, while the sulfonamide moiety can exhibit biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may have specific melting and boiling points, as well as solubility characteristics in various solvents. Its applications may include use as a pharmaceutical intermediate or in the development of sulfonamide-based drugs. Safety data should be consulted for handling and exposure guidelines, as sulfonamides can have varying effects on human health and the environment.
Formula:C11H17NO4S
InChI:InChI=1S/C11H17NO4S/c1-9-4-6-10(7-5-9)17(13,14)12-8-11(15-2)16-3/h4-7,11-12H,8H2,1-3H3
InChI key:YSQNRFLBFRHJBP-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)NCC(OC)OC
Found 1 products.