CAS 5876-17-5

Haplopine

Description:

Haplopine, with the CAS number 5876-17-5, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. It is primarily derived from certain plant species and is known for its potential pharmacological properties. Haplopine exhibits a complex molecular structure, which contributes to its biological activity. The compound has been studied for its effects on various biological systems, including its potential use in medicinal applications. Its characteristics include solubility in organic solvents, and it may exhibit varying degrees of stability under different environmental conditions. As with many alkaloids, haplopine may also demonstrate a range of effects on the central nervous system and other physiological processes. However, detailed studies on its toxicity, pharmacokinetics, and specific applications are essential for understanding its full potential and safety profile. As research continues, haplopine may reveal further insights into its utility in therapeutic contexts.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1S/C13H11NO4/c1-16-11-7-3-4-9(15)12(17-2)10(7)14-13-8(11)5-6-18-13/h3-6,15H,1-2H3

InChI key: InChIKey=LJKPBWHZRNQEMO-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(OC)=C3C(=N2)OC=C3)=CC=C1O

Synonyms:

• 4,8-Dimethoxyfuro[2,3-b]quinolin-7-ol
• 7-Hydroxy-8-methoxydictamnine
• Furo[2,3-b]quinolin-7-ol, 4,8-dimethoxy-
• Haplopine
• furo[2,3-b]quinolin-7(9H)-one, 4,8-dimethoxy-

4,8-Dimethoxyfuro[2,3-b]quinolin-7-ol

CAS: 5876-17-5

Formula: C₁₃H₁₁NO₄

Purity: 98%

Molecular weight: 245.2307

Ref: IN-DA00EK7D

Haplopine

CAS: 5876-17-5

Haplopine: photo-activated anti-S. aureus; inhibits melanogenesis with low toxicity.

Formula: C₁₃H₁₁NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 245.23

Ref: TM-TC0017

Haplopine

CAS: 5876-17-5

Formula: C₁₃H₁₁NO₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 245.234

Ref: BP-SBP02717

Haplopine

CAS: 5876-17-5

Haplopine is a novel phytochemical compound, which is derived from specific plant species known for their bioactive properties. Its primary source is the extracts obtained from traditional medicinal plants, which have been identified through extensive ethnobotanical studies. Haplopine functions through a unique mode of action, primarily by interacting with specific signaling pathways and modulating gene expression.

Formula: C₁₃H₁₁NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 245.23 g/mol

Ref: 3D-FAA87617