CAS 5876-76-6
:4-phenylbut-3-yn-2-ol
Description:
4-Phenylbut-3-yn-2-ol, with the CAS number 5876-76-6, is an organic compound characterized by its alkyne functional group and a hydroxyl group. It features a butyne backbone with a phenyl substituent at the fourth carbon and a hydroxyl group at the second carbon. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and fine chemicals. The presence of both the alkyne and alcohol functional groups allows for diverse reactivity, including nucleophilic additions and coupling reactions. Its molecular structure contributes to its unique physical and chemical properties, such as solubility in organic solvents and moderate stability under standard conditions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with organic compounds.
Formula:C10H10O
InChI:InChI=1/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,1H3
SMILES:CC(C#Cc1ccccc1)O
Synonyms:- 3-Butyn-2-Ol, 4-Phenyl-
- Methylphenylethynylcarbinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Phenyl-3-butyn-2-ol, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H10OPurity:97%Molecular weight:146.19



