
CAS 58765-21-2
:2-Bromo-4-(2-chlorophenyl)-9-cyclohexyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
Description:
2-Bromo-4-(2-chlorophenyl)-9-cyclohexyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine is a complex organic compound characterized by its unique structural features, including a thieno[3,2-f] ring system fused with a triazolo[4,3-a]diazepine moiety. This compound contains bromine and chlorine substituents, which can influence its reactivity and biological activity. The presence of a cyclohexyl group contributes to its hydrophobic character, potentially affecting its solubility and interaction with biological membranes. The compound's structure suggests potential pharmacological properties, as many diazepine derivatives are known for their activity in the central nervous system. Its specific interactions and effects would depend on the arrangement of functional groups and the overall three-dimensional conformation. As with many synthetic organic compounds, understanding its characteristics requires consideration of its synthesis, stability, and potential applications in medicinal chemistry or material science. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C20H18BrClN4S
InChI:InChI=1S/C20H18BrClN4S/c21-16-10-14-18(13-8-4-5-9-15(13)22)23-11-17-24-25-19(26(17)20(14)27-16)12-6-2-1-3-7-12/h4-5,8-10,12H,1-3,6-7,11H2
InChI key:InChIKey=ZOSHXIXUCKESEG-UHFFFAOYSA-N
SMILES:BrC=1SC=2N3C(=NN=C3CN=C(C2C1)C4=C(Cl)C=CC=C4)C5CCCCC5
Synonyms:- 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 2-bromo-4-(2-chlorophenyl)-9-cyclohexyl-
- 2-Bromo-4-(2-chlorophenyl)-9-cyclohexyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
- We 973BS
- Ciclotizolam
- We 973
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ciclotizolam
CAS:Ciclotizolam, a thienotriazolodiazepine derivative and partial GABAA receptor agonist, has low efficacy but similar affinity as brotizolam.Formula:C20H18BrClN4SColor and Shape:SolidMolecular weight:461.81
