CAS 58783-12-3
:copper(2+) decanedioate
Description:
Copper(2+) decanedioate, also known as copper sebacate, is a coordination compound formed from copper ions and decanedioic acid (sebacic acid). This substance typically appears as a blue or green solid, reflecting the characteristic color of copper compounds. It is soluble in polar solvents, such as water and alcohols, due to the presence of the decanedioate ligand, which enhances its solubility. The compound exhibits coordination chemistry, where the copper ion is coordinated by the carboxylate groups of the decanedioate, leading to a stable complex. Copper(2+) decanedioate is often studied for its potential applications in catalysis, materials science, and as a precursor in the synthesis of other copper-containing compounds. Additionally, it may exhibit antimicrobial properties, making it of interest in various biomedical applications. As with many copper compounds, it is important to handle it with care due to potential toxicity, particularly in high concentrations. Overall, copper(2+) decanedioate is a versatile compound with significant relevance in both industrial and research settings.
Formula:C10H16CuO4
InChI:InChI=1/C10H18O4.Cu/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;/h1-8H2,(H,11,12)(H,13,14);/q;+2/p-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cupric sebacate
CAS:<p>Cupric sebacate is a biochemical.</p>Formula:C10H18CuO4Color and Shape:SolidMolecular weight:265.79
