CAS 587851-03-4
:(2-Amino-4-ethyl-5-methyl-3-thienyl)-1-piperidinylmethanone
Description:
(2-Amino-4-ethyl-5-methyl-3-thienyl)-1-piperidinylmethanone, identified by its CAS number 587851-03-4, is a chemical compound that features a complex structure incorporating both a thienyl group and a piperidine moiety. This compound is characterized by the presence of an amino group, which contributes to its potential as a biological active agent. The thienyl ring, a five-membered heterocyclic structure containing sulfur, imparts unique electronic properties and can influence the compound's reactivity and interaction with biological targets. The ethyl and methyl substituents on the thienyl ring enhance its lipophilicity, potentially affecting its pharmacokinetic properties. The piperidine ring adds to the overall basicity of the molecule, which may play a role in its binding affinity to various receptors. Overall, this compound may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C13H20N2OS
InChI:InChI=1S/C13H20N2OS/c1-3-10-9(2)17-12(14)11(10)13(16)15-7-5-4-6-8-15/h3-8,14H2,1-2H3
InChI key:InChIKey=CCFJZLLSLUHEPL-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(CC)=C(C)SC1N)N2CCCCC2
Synonyms:- Piperidine, 1-[(2-amino-4-ethyl-5-methyl-3-thienyl)carbonyl]-
- (2-Amino-4-ethyl-5-methyl-3-thienyl)-1-piperidinylmethanone
- Methanone, (2-amino-4-ethyl-5-methyl-3-thienyl)-1-piperidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.