CAS 58791-78-9

5-amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carbonitrile

Description:

5-amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group and a cyano group at specific positions on the pyrazole ring contributes to its reactivity and potential biological activity. The 3,4-dichlorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of agrochemicals or as a lead compound in drug discovery due to its structural features that may exhibit anti-inflammatory or anti-cancer properties. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.

Formula: C₁₀H₆Cl₂N₄

InChI: InChI=1/C10H6Cl2N4/c11-8-2-1-7(3-9(8)12)16-10(14)6(4-13)5-15-16/h1-3,5H,14H2

SMILES: c1cc(c(cc1n1c(c(C#N)cn1)N)Cl)Cl

Synonyms:

• 1H-pyrazole-4-carbonitrile, 5-amino-1-(3,4-dichlorophenyl)-
• 5-AMINO-1-(3,4-DICHLOROPHENYL)-1H-PYRAZOLE-4-CARBONITRILE

5-Amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carbonitrile

CAS: 58791-78-9

Formula: C₁₀H₆Cl₂N₄

Color and Shape: Solid

Molecular weight: 253.0874

Ref: IN-DA00EB9X

5-Amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carbonitrile

CAS: 58791-78-9

5-Amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carbonitrile

Formula: C₁₀H₆Cl₂N₄

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 253.09g/mol

Ref: 54-OR14183