CAS 588-09-0

2-Chloro-5-(trifluoromethoxy)nitrobenzene

Description:

2-Chloro-5-(trifluoromethoxy)nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. The presence of the trifluoromethoxy group (-O-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. This compound is typically a pale yellow solid at room temperature and is known for its stability under standard conditions. It is often utilized in various chemical syntheses and as an intermediate in the production of agrochemicals and pharmaceuticals. The trifluoromethoxy group can impart unique electronic properties, making the compound of interest in medicinal chemistry and materials science. Additionally, due to the presence of chlorine and nitro groups, it may exhibit specific reactivity patterns, such as electrophilic substitution. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.

Formula: C₇H₃ClF₃NO₃

InChI: InChI=1S/C7H3ClF3NO3/c8-5-2-1-4(15-7(9,10)11)3-6(5)12(13)14/h1-3H

SMILES: c1cc(c(cc1OC(F)(F)F)N(=O)=O)Cl

Synonyms:

• 4-Chloro-3-nitrophenyl trifluoromethyl ether
• 1-Chloro-2-nitro-4-(trifluoromethoxy)benzene

2-Chloro-5-(trifluoroMethoxy)nitrobenzene

CAS: 588-09-0

Formula: C₇H₃ClF₃NO₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 241.5518

Ref: IN-DA003GY3

1-Chloro-2-nitro-4-(trifluoromethoxy)benzene

CAS: 588-09-0

1-Chloro-2-nitro-4-(trifluoromethoxy)benzene

Purity: 98%

Molecular weight: 241.55g/mol

Ref: 54-PC902041

1-Chloro-2-nitro-4-(trifluoromethoxy)benzene

CAS: 588-09-0

Formula: C₇H₃ClF₃NO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 241.55

Ref: 10-F211759