CAS 588-17-0

Benzenaminium, 3-[[(dimethylamino)carbonyl]oxy]-N,N,N-trimethyl-, hydroxide (1:1)

Description:

Benzenaminium, 3-[[[dimethylamino]carbonyl]oxy]-N,N,N-trimethyl-, hydroxide (1:1), commonly referred to as a quaternary ammonium compound, is characterized by its complex structure that includes a benzene ring, a dimethylamino group, and a hydroxide ion. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in water and facilitate interactions with biological membranes. It is often used in various applications, including as a reagent in organic synthesis and as a potential antimicrobial agent due to its ability to disrupt microbial cell membranes. The presence of the hydroxide ion suggests that it may also exhibit basic properties. Additionally, the dimethylamino group can participate in hydrogen bonding and may influence the compound's reactivity and interaction with other chemical species. Overall, this substance is notable for its multifunctional characteristics, making it valuable in both industrial and research settings.

Formula: C₁₂H₁₉N₂O₂·HO

InChI: InChI=1S/C12H19N2O2.H2O/c1-13(2)12(15)16-11-8-6-7-10(9-11)14(3,4)5;/h6-9H,1-5H3;1H2/q+1;/p-1

InChI key: InChIKey=GTPJMRHVDZUPND-UHFFFAOYSA-M

SMILES: O(C(N(C)C)=O)C1=CC([N+](C)(C)C)=CC=C1.[OH-]

Synonyms:

• Benzenaminium, 3-[[(dimethylamino)carbonyl]oxy]-N,N,N-trimethyl-, hydroxide
• Ammonium, (m-hydroxyphenyl)trimethyl-, hydroxide, dimethylcarbamate
• Miostin
• Benzenaminium, 3-[[(dimethylamino)carbonyl]oxy]-N,N,N-trimethyl-, hydroxide (1:1)

Neostigmine hydroxide

CAS: 588-17-0

Neostigmine hydroxide, a cholinesterase inhibitor, treats myasthenia gravis and reverses muscle relaxants; doesn't cross the blood-brain barrier.

Formula: C₁₂H₂₀N₂O₃

Color and Shape: Solid

Molecular weight: 240.3

Ref: TM-T69050