CAS 588-22-7
:(3,4-Dichlorophenoxy)acetic acid
Description:
(3,4-Dichlorophenoxy)acetic acid, commonly known as dicamba, is a synthetic herbicide widely used in agriculture for controlling broadleaf weeds. It belongs to the class of compounds known as phenoxy acids. The chemical structure features a dichlorophenyl group attached to an acetic acid moiety, which contributes to its herbicidal properties. Dicamba is characterized by its systemic action, allowing it to be absorbed by plant foliage and roots, leading to growth disruption and eventual plant death. It is typically applied to crops such as corn and soybeans, often in combination with other herbicides to enhance efficacy. The substance is moderately soluble in water and has a relatively low volatility, which helps minimize drift during application. However, dicamba has been associated with off-target effects, leading to concerns about its environmental impact and potential harm to non-target plants. Regulatory agencies monitor its use, and guidelines are established to mitigate risks associated with its application. Overall, dicamba is an important tool in modern agriculture, but its use requires careful management to prevent unintended consequences.
Formula:C8H6Cl2O3
InChI:InChI=1S/C8H6Cl2O3/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12)
InChI key:InChIKey=SNYRXHULAWEECU-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- (3,4-Dichlorophenoxy)acetic acid
- 2-(3,4-Dichlorophenoxy)acetic acid
- 3,4-D
- 3,4-Da
- Acetic acid, (3,4-dichlorophenoxy)-
- Acetic acid, 2-(3,4-dichlorophenoxy)-
- Brn 1969638
- Nsc 39017
- Nsc 525057
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dichlorophenoxyacetic acid
CAS:Formula:C8H6Cl2O3Purity:97%Color and Shape:SolidMolecular weight:221.03742-(3,4-Dichlorophenoxy)acetic acid
CAS:2-(3,4-Dichlorophenoxy)acetic acidPurity:97%Molecular weight:221.04g/mol3,4-Dichlorophenoxyacetic acid
CAS:Controlled ProductApplications 3,4-Dichlorophenoxyacetic acid is a synthesis reagent.
Formula:C8H6Cl2O3Color and Shape:NeatMolecular weight:221.042-(3,4-Dichlorophenoxy)acetic acid
CAS:2-(3,4-Dichlorophenoxy)acetic acid is a herbicide that has a phenoxyacetic structure. It inhibits photosynthesis in plants by blocking the action of the enzyme ribulose-1,5-bisphosphate carboxylase. This causes chlorophyll synthesis to be disrupted and the plant to die. 2-(3,4-Dichlorophenoxy)acetic acid also inhibits acetolactate synthase and other enzymes in plants that are necessary for amino acid synthesis.Formula:C8H6Cl2O3Purity:Min. 95%Molecular weight:221.04 g/mol




