CAS 588-92-1
:N-[4-(acetylamino)phenyl]glycine
Description:
N-[4-(Acetylamino)phenyl]glycine, with the CAS number 588-92-1, is an organic compound that belongs to the class of amino acids and derivatives. It features an acetylamino group attached to a phenyl ring, which is further connected to a glycine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, reflecting its polar functional groups. The presence of both an amino group and a carboxylic acid group allows it to participate in various chemical reactions, including peptide bond formation. N-[4-(Acetylamino)phenyl]glycine is of interest in pharmaceutical research due to its potential biological activities, including anti-inflammatory and analgesic properties. Its structural characteristics enable it to interact with biological systems, making it a subject of study in medicinal chemistry. Proper handling and storage are essential, as with many chemical substances, to ensure safety and maintain stability.
Formula:C10H12N2O3
InChI:InChI=1/C10H12N2O3/c1-7(13)12-9-4-2-8(3-5-9)11-6-10(14)15/h2-5,11H,6H2,1H3,(H,12,13)(H,14,15)
SMILES:CC(=Nc1ccc(cc1)NCC(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-[4-(Acetylamino)phenyl]glycine
CAS:N-[4-(Acetylamino)phenyl]glycine is a fine chemical that can be used as a building block in the synthesis of pharmaceuticals, agricultural chemicals, and other speciality chemicals. It is an intermediate in the synthesis of heterocyclic compounds and has been shown to be useful for the preparation of complex compounds. N-[4-(Acetylamino)phenyl]glycine also serves as a reaction component in many organic reactions and has been used as a research chemical. This compound has high purity and can be obtained at competitive prices.Formula:C10H12N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:208.21 g/mol
