CAS 58808-59-6
:4-(trifluoroacetyl)benzoic acid
Description:
4-(Trifluoroacetyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a trifluoroacetyl group attached to the para position of a benzoic acid moiety. This compound typically appears as a white to off-white solid and is known for its strong acidity due to the carboxylic acid functional group. The trifluoroacetyl group enhances the compound's reactivity and polarity, making it useful in various chemical reactions, including acylation and as a building block in organic synthesis. It is soluble in polar organic solvents, which facilitates its use in laboratory settings. Additionally, the presence of fluorine atoms contributes to its unique electronic properties, potentially influencing its behavior in biological systems and materials science. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 4-(trifluoroacetyl)benzoic acid is a valuable compound in synthetic organic chemistry and materials research.
Formula:C9H5F3O3
InChI:InChI=1/C9H5F3O3/c10-9(11,12)7(13)5-1-3-6(4-2-5)8(14)15/h1-4H,(H,14,15)
SMILES:c1cc(ccc1C(=O)C(F)(F)F)C(=O)O
Synonyms:- 4-Carboxy-alpha,alpha,alpha-trifluoroacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Trifluoroacetyl)benzoic acid, 97+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H5F3O3Purity:97+%Color and Shape:White to cream, Crystals or powder or crystalline powder or fused solid or flakesMolecular weight:218.134-(Trifluoroacetyl)Benzoic Acid
CAS:Formula:C9H5F3O3Purity:97%Color and Shape:SolidMolecular weight:218.12944-(Trifluoroacetyl)benzoic acid
CAS:4-(Trifluoroacetyl)benzoic acidFormula:C9H5F3O3Purity:97%Color and Shape: white crystalline solidMolecular weight:218.13g/mol4-(Trifluoroacetyl)benzoic acid
CAS:Formula:C9H5F3O3Purity:98%Color and Shape:SolidMolecular weight:218.131



