CAS 58820-36-3
:1-(4-Chloro-2-methylphenyl)piperazine
Description:
1-(4-Chloro-2-methylphenyl)piperazine, with the CAS number 58820-36-3, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered cyclic amine, substituted with a 4-chloro-2-methylphenyl group. This substitution imparts specific pharmacological properties, making it of interest in medicinal chemistry. The compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many piperazine derivatives. Its molecular structure suggests potential interactions with various biological targets, which may include neurotransmitter receptors, making it relevant in the study of psychotropic effects. The presence of the chloro and methyl groups can influence its lipophilicity and biological activity. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 1-(4-Chloro-2-methylphenyl)piperazine is a compound of interest for further research in pharmacology and medicinal chemistry.
Formula:C11H15ClN2
InChI:InChI=1S/C11H15ClN2/c1-9-8-10(12)2-3-11(9)14-6-4-13-5-7-14/h2-3,8,13H,4-7H2,1H3
InChI key:InChIKey=MXEFOSLEAQWWDM-UHFFFAOYSA-N
SMILES:CC1=C(N2CCNCC2)C=CC(Cl)=C1
Synonyms:- 1-(4-Chloro-2-Methylphenyl)Piperazine
- 4-(2-Methyl-4-chlorophenyl)piperazine
- Piperazine, 1-(4-chloro-2-methylphenyl)-
- 1-(4-Chloro-o-tolyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.