CAS 58822-47-2
:Secoxyloganin
Description:
Secoxyloganin, with the CAS number 58822-47-2, is a chemical compound that belongs to the class of iridoids, which are a type of monoterpenoid. It is primarily derived from various plant sources and is known for its potential pharmacological properties. Secoxyloganin exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential neuroprotective effects. Its structure features a bicyclic framework typical of iridoids, contributing to its unique chemical properties. The compound is often studied for its role in traditional medicine and its potential therapeutic applications. Additionally, secoxyloganin may interact with various biological pathways, making it a subject of interest in pharmacognosy and natural product research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its extraction and application in medicinal chemistry. Overall, secoxyloganin represents a significant compound in the study of natural products and their potential health benefits.
Formula:C17H24O11
InChI:InChI=1S/C17H24O11/c1-3-7-8(4-11(19)20)9(15(24)25-2)6-26-16(7)28-17-14(23)13(22)12(21)10(5-18)27-17/h3,6-8,10,12-14,16-18,21-23H,1,4-5H2,2H3,(H,19,20)/t7-,8+,10-,12-,13+,14-,16+,17+/m1/s1
InChI key:InChIKey=MQLSOVRLZHTATK-PEYNGXJCSA-N
SMILES:C(=C)[C@@H]1[C@H](CC(O)=O)C(C(OC)=O)=CO[C@H]1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- (2S,3R,4S)-3-Ethenyl-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-2H-pyran-4-acetic acid
- Secologanoside 11-methyl ester
- 2H-Pyran-4-acetic acid, 3-ethenyl-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, (2S,3R,4S)-
- Secoxyloganin
- 2H-Pyran-4-acetic acid, 3-ethenyl-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, [2S-(2α,3β,4β)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Secoxyloganin ([(2S,3R,4S)-2-(β-D-Glucopyranosyloxy)-5-(methoxycarbonyl)-3-vinyl-3,4-dihydro-2H-pyran-4-yl]acetic acid)
CAS:Other glycosides, natural or reproduced by synthesis, and their salts, ethers, esters and other derivativesFormula:C17H24O11Color and Shape:White Off-White PowderMolecular weight:404.13186Secoxyloganin
CAS:Secoxyloganin possesses a hepato-protective effect.Formula:C17H24O11Purity:99.45% - ≥95%Color and Shape:SolidMolecular weight:404.37Secoxyloganin
CAS:Natural glycosideFormula:C17H24O11Purity:≥ 95.0 % (HPLC)Color and Shape:CrystalsMolecular weight:404.37Secoxyloganin
CAS:Secoxyloganin is a 4-hydroxycinnamic acid that belongs to the group of caffeic acids. It is an iridoid, which is a type of monoterpene indole alkaloid that has been found in various plants. Secoxyloganin can be found in the roots, stems, and leaves of plants such as Securigera varia and Digitalis purpurea. Secoxyloganin has shown antimicrobial activity against Gram-positive bacteria such as Staphylococcus aureus and Gram-negative bacteria such as Pseudomonas aeruginosa. It also has antiviral properties, which may be due to its ability to inhibit RNA synthesis and protein synthesis. Secoxyloganin has been shown to have physiological effects in vitro assays, including an increase in glucose uptake by cells after injection of glucose into the cell culture medium.Formula:C17H24O11Purity:Min. 95%Molecular weight:404.37 g/mol








