CymitQuimica logo

CAS 58827-68-2

:

4-[4-(oxiran-2-ylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine

Description:
4-[4-(Oxiran-2-ylmethoxy)-1,2,5-thiadiazol-3-yl]morpholine, with the CAS number 58827-68-2, is a chemical compound characterized by its unique structural features, including a morpholine ring and a thiadiazole moiety. The presence of an epoxide group (oxiran) contributes to its reactivity, making it potentially useful in various chemical reactions, such as ring-opening reactions or as a building block in organic synthesis. The thiadiazole ring is known for its biological activity, often exhibiting antimicrobial and antifungal properties, which may suggest potential applications in pharmaceuticals or agrochemicals. Morpholine, a cyclic amine, adds to the compound's solubility and potential interactions with biological systems. Overall, this compound's combination of functional groups may provide diverse applications in medicinal chemistry, materials science, or as a synthetic intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential hazards associated with its reactive groups.
Formula:C9H13N3O3S
InChI:InChI=1/C9H13N3O3S/c1-3-13-4-2-12(1)8-9(11-16-10-8)15-6-7-5-14-7/h7H,1-6H2
SMILES:C1COCCN1c1c(nsn1)OCC1CO1
Synonyms:
  • Morpholine, 4-[4-(Oxiranylmethoxy)-1,2,5-Thiadiazol-3-Yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.