CAS 58863-48-2
:Benzofuran, 3-bromo-2-methyl-
Description:
Benzofuran, 3-bromo-2-methyl- is an organic compound characterized by its fused benzene and furan rings, with a bromine atom and a methyl group attached to the benzofuran structure. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions or coupling reactions. The methyl group enhances the hydrophobic nature of the molecule, influencing its solubility in organic solvents. Benzofuran derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. Additionally, the compound's structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H7BrO
InChI:InChI=1S/C9H7BrO/c1-6-9(10)7-4-2-3-5-8(7)11-6/h2-5H,1H3
InChI key:OEGMISNFEAVBHA-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC=CC=C2O1)Br
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Bromo-2-methylbenzofuran
CAS:3-Bromo-2-methylbenzofuranFormula:C9H7BrOPurity:>97%Color and Shape:LiquidMolecular weight:211.055283-Bromo-2-methylbenzofuran
CAS:3-Bromo-2-methylbenzofuranFormula:C9H7BrOPurity:98%Molecular weight:211.063-BROMO-2-METHYLBENZOFURAN
CAS:Formula:C9H7BrOPurity:97%Color and Shape:LiquidMolecular weight:211.0583-Bromo-2-methylbenzofuran
CAS:3-Bromo-2-methylbenzofuran is a chiral compound that has been shown to stabilize the DNA of irradiated, homochiral DNA. It is also used as an intermediate in the synthesis of other compounds. 3-Bromo-2-methylbenzofuran has a high melting point, which makes it difficult to purify. The compound crystallizes unsymmetrically and fluoresces. It can undergo photochromism and isomerization under ultraviolet light. 3-Bromo-2-methylbenzofuran has a low solubility in water and can be toxic if inhaled or ingested. This compound exhibits fluorescence properties, which may be due to its ability to absorb light at wavelengths longer than 400 nm and emit light at wavelengths shorter than 400 nm.
Formula:C9H7BrOPurity:Min. 95%Molecular weight:211.06 g/mol




