CAS 588673-43-2

5-[1-(4-tert-butylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-tert-butylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 588673-43-2, is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of a tert-butylphenoxy group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The ethyl linkage connects the phenoxy group to the triazole structure, which may affect the compound's overall conformation and stability. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of functional groups and the overall molecular structure can significantly impact the compound's properties, including its reactivity, biological activity, and potential applications in various fields.

Formula: C₁₅H₂₁N₃OS

InChI: InChI=1/C15H21N3OS/c1-10(13-16-17-14(20)18(13)5)19-12-8-6-11(7-9-12)15(2,3)4/h6-10H,1-5H3,(H,17,20)

SMILES: CC(c1nnc(n1C)S)Oc1ccc(cc1)C(C)(C)C

5-[1-(4-tert-Butylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-43-2

Formula: C₁₅H₂₁N₃OS

Molecular weight: 291.4117

Ref: IN-DA00EA4Q

5-[1-(4-tert-butylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-43-2

Formula: C₁₅H₂₁N₃OS

Purity: 95.0%

Molecular weight: 291.41

Ref: 10-F307815