CAS 588673-46-5

5-[1-(3,5-dimethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(3,5-dimethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 588673-46-5, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 3,5-dimethylphenoxyethyl substituent suggests that it may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The compound's structure implies potential applications in agricultural chemistry, particularly as a fungicide or herbicide, due to the triazole moiety's known efficacy in inhibiting fungal growth. Additionally, the methyl groups on the aromatic ring may enhance its stability and lipophilicity. Overall, this compound's unique structural features position it as a candidate for further research in medicinal and agricultural chemistry.

Formula: C₁₃H₁₇N₃OS

InChI: InChI=1/C13H17N3OS/c1-8-5-9(2)7-11(6-8)17-10(3)12-14-15-13(18)16(12)4/h5-7,10H,1-4H3,(H,15,18)

SMILES: Cc1cc(C)cc(c1)OC(C)c1nnc(n1C)S

5-[1-(3,5-Dimethylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-46-5

Formula: C₁₃H₁₇N₃OS

Molecular weight: 263.3586

Ref: IN-DA00EC48

5-[1-(3,5-dimethylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-46-5

Formula: C₁₃H₁₇N₃OS

Purity: 95.0%

Molecular weight: 263.36

Ref: 10-F307803