CAS 588673-47-6

5-[(4-chloro-2-methylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(4-chloro-2-methylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of a chloro-substituted methylphenoxy group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The compound's structure suggests it may exhibit fungicidal or herbicidal properties, making it of interest in agricultural chemistry. Additionally, the triazole moiety is known for its role in various pharmacological applications, including antifungal agents. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a class of chemicals that may have significant applications in both agriculture and pharmaceuticals.

Formula: C₁₁H₁₂ClN₃OS

InChI: InChI=1/C11H12ClN3OS/c1-7-5-8(12)3-4-9(7)16-6-10-13-14-11(17)15(10)2/h3-5H,6H2,1-2H3,(H,14,17)

SMILES: Cc1cc(ccc1OCc1nnc(n1C)S)Cl

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[(4-chloro-2-methylphenoxy)methyl]-4-methyl-

5-[(4-chloro-2-methylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-47-6

Formula: C₁₁H₁₂ClN₃OS

Purity: 95.0%

Molecular weight: 269.75

Ref: 10-F307715