CAS 588673-51-2

4-methyl-5-[1-(2-methylphenoxy)ethyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-[1-(2-methylphenoxy)ethyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 2-methylphenoxy group suggests that the compound may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The methyl substituent on the triazole ring can affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. This compound may be of interest in agricultural or medicinal chemistry due to its structural features, which could confer specific biological activities, such as fungicidal or herbicidal properties. However, detailed studies would be necessary to elucidate its exact mechanisms of action and potential applications.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-8-6-4-5-7-10(8)16-9(2)11-13-14-12(17)15(11)3/h4-7,9H,1-3H3,(H,14,17)

SMILES: Cc1ccccc1OC(C)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-methyl-5-[1-(2-methylphenoxy)ethyl]-