CAS 588673-53-4

5-[1-(4-chloro-2-methylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-chloro-2-methylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 588673-53-4, is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of a chloro-substituted aromatic ring enhances its lipophilicity and may influence its interaction with biological targets. The ethyl and methyl substituents provide additional steric and electronic effects that can modulate the compound's properties. This substance may exhibit various pharmacological activities, making it of interest in medicinal chemistry and agrochemical applications. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall structure. Further studies would be necessary to elucidate its full potential and applications in various fields.

Formula: C₁₂H₁₄ClN₃OS

InChI: InChI=1/C12H14ClN3OS/c1-7-6-9(13)4-5-10(7)17-8(2)11-14-15-12(18)16(11)3/h4-6,8H,1-3H3,(H,15,18)

SMILES: Cc1cc(ccc1OC(C)c1nnc(n1C)S)Cl

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[1-(4-chloro-2-methylphenoxy)ethyl]-4-methyl-

5-[1-(4-Chloro-2-methylphenoxy)ethyl]-4-methyl-4h-1,2,4-triazole-3-thiol

CAS: 588673-53-4

Formula: C₁₂H₁₄ClN₃OS

Molecular weight: 283.7771

Ref: IN-DA00EC4S

5-[1-(4-chloro-2-methylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-53-4

Formula: C₁₂H₁₄ClN₃OS

Purity: 95.0%

Molecular weight: 283.77

Ref: 10-F307718