CAS 588673-86-3

5-[(2,5-dimethylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(2,5-Dimethylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 2,5-dimethylphenoxy group suggests that it may exhibit hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. The ethyl group further enhances its lipophilicity. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities, such as antifungal or antibacterial properties. Its specific applications and efficacy would depend on further studies and evaluations. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₃H₁₇N₃OS

InChI: InChI=1/C13H17N3OS/c1-4-16-12(14-15-13(16)18)8-17-11-7-9(2)5-6-10(11)3/h5-7H,4,8H2,1-3H3,(H,15,18)

SMILES: CCn1c(COc2cc(C)ccc2C)nnc1S

5-[(2,5-dimethylphenoxy)methyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-86-3

Formula: C₁₃H₁₇N₃OS

Purity: 95.0%

Molecular weight: 263.36

Ref: 10-F307747