CAS 588673-94-3

5-[(3,4-dimethylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(3,4-Dimethylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 3,4-dimethylphenoxy group suggests that it may exhibit hydrophobic characteristics, enhancing its solubility in organic solvents. The ethyl group attached to the triazole ring may influence its steric properties and overall molecular interactions. This compound is of interest in various fields, including medicinal chemistry and agricultural science, due to its potential applications as a fungicide or herbicide. Its specific properties, such as melting point, solubility, and biological activity, would require empirical investigation to fully understand its behavior in different environments.

Formula: C₁₃H₁₇N₃OS

InChI: InChI=1/C13H17N3OS/c1-4-16-12(14-15-13(16)18)8-17-11-6-5-9(2)10(3)7-11/h5-7H,4,8H2,1-3H3,(H,15,18)

SMILES: CCn1c(COc2ccc(C)c(C)c2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[(3,4-dimethylphenoxy)methyl]-4-ethyl-

5-[(3,4-dimethylphenoxy)methyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 588673-94-3

Formula: C₁₃H₁₇N₃OS

Purity: 95.0%

Molecular weight: 263.36

Ref: 10-F307758