CAS 588674-33-3

5-[(2,5-dichlorophenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(2,5-Dichlorophenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The dichlorophenoxy group suggests that the compound may exhibit herbicidal or fungicidal properties, as phenoxy herbicides are commonly used in agriculture. The presence of the methyl group enhances its lipophilicity, potentially affecting its solubility and absorption characteristics. This compound may be of interest in the field of agrochemicals, particularly for its potential applications in pest control. Its specific interactions, stability, and efficacy would depend on various factors, including environmental conditions and the presence of other substances. As with any chemical, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₀H₉Cl₂N₃OS

InChI: InChI=1/C10H9Cl2N3OS/c1-15-9(13-14-10(15)17)5-16-8-4-6(11)2-3-7(8)12/h2-4H,5H2,1H3,(H,14,17)

SMILES: Cn1c(COc2cc(ccc2Cl)Cl)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[(2,5-dichlorophenoxy)methyl]-4-methyl-

5-[(2,5-dichlorophenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588674-33-3

Formula: C₁₀H₉Cl₂N₃OS

Purity: 95.0%

Molecular weight: 290.16

Ref: 10-F307765