CAS 588674-76-4

5-(5-ethylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(5-ethylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The ethylthiophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The compound is likely to exhibit properties typical of triazoles, such as antifungal or antimicrobial activity, although specific biological activities would require empirical investigation. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of new therapeutic agents. Additionally, the presence of the thione group may impart unique chemical reactivity, making it a candidate for further research in synthetic chemistry. As with any chemical substance, safety and handling precautions should be observed, and its environmental impact should be assessed in relevant applications.

Formula: C₉H₁₁N₃S₂

InChI: InChI=1/C9H11N3S2/c1-3-7-4-6(5-14-7)8-10-11-9(13)12(8)2/h4-5H,3H2,1-2H3,(H,11,13)

SMILES: CCc1cc(cs1)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(5-ethyl-3-thienyl)-4-methyl-
• 5-(5-Ethyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

5-(5-Ethylthien-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588674-76-4

Formula: C₉H₁₁N₃S₂

Molecular weight: 225.3337

Ref: IN-DA00EE8H

5-(5-ethyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588674-76-4

Formula: C₉H₁₁N₃S₂

Purity: 95.0%

Molecular weight: 225.33

Ref: 10-F307681