CAS 588677-32-1

8-Chloro-2-(3-methylphenyl)-4-quinolinecarboxylic acid

Description:

8-Chloro-2-(3-methylphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which features a chloro substituent and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the chloro group can influence its reactivity and solubility, while the carboxylic acid group may contribute to its acidity and ability to form salts or esters. The 3-methylphenyl substituent adds to the compound's hydrophobic characteristics, which can affect its interactions in biological systems. Such compounds are often studied for their potential pharmacological applications, including antimicrobial or anticancer properties. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, making it of interest in synthetic organic chemistry. Overall, 8-Chloro-2-(3-methylphenyl)-4-quinolinecarboxylic acid represents a unique combination of functional groups that may confer specific chemical and biological properties.

Formula: C₁₇H₁₂ClNO₂

InChI: InChI=1S/C17H12ClNO2/c1-10-4-2-5-11(8-10)15-9-13(17(20)21)12-6-3-7-14(18)16(12)19-15/h2-9H,1H3,(H,20,21)

InChI key: InChIKey=GPHOCYQTDFLPOV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC(C)=CC=C3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarboxylic Acid, 8-Chloro-2-(3-Methylphenyl)-
• 8-Chloro-2-(3-methylphenyl)-4-quinolinecarboxylic acid

8-chloro-2-(3-methylphenyl)quinoline-4-carboxylic acid

CAS: 588677-32-1

Purity: 95.0%

Molecular weight: 297.739990234375

Ref: 10-F307489