CAS 588680-03-9

2-(4-bromo-2-chlorophenoxy)acetohydrazide

Description:

2-(4-bromo-2-chlorophenoxy)acetohydrazide is a chemical compound characterized by its hydrazide functional group, which is linked to a phenoxyacetyl moiety. The presence of bromine and chlorine substituents on the aromatic ring contributes to its unique reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may vary depending on the pH and temperature. The presence of halogen atoms can enhance its lipophilicity, influencing its interaction with biological systems. As a hydrazide, it may participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests potential for antimicrobial or anti-inflammatory properties, although specific biological activities would require empirical investigation. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with exposure or reactivity.

Formula: C₈H₈BrClN₂O₂

InChI: InChI=1/C8H8BrClN2O2/c9-5-1-2-7(6(10)3-5)14-4-8(13)12-11/h1-3H,4,11H2,(H,12,13)

SMILES: c1cc(c(cc1Br)Cl)OCC(=NN)O

Synonyms:

• Acetic Acid, 2-(4-Bromo-2-Chlorophenoxy)-, Hydrazide

2-(4-Bromo-2-chlorophenoxy)acetohydrazide

CAS: 588680-03-9

Formula: C₈H₈BrClN₂O₂

Purity: 95.0%

Molecular weight: 279.52

Ref: 10-F061385