CAS 588680-35-7

5-(5-methylthiophen-3-yl)-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(5-methylthiophen-3-yl)-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 588680-35-7, is a chemical compound characterized by its unique structural features, including a triazole ring and a thiophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of sulfur and nitrogen atoms in its structure. The triazole moiety is known for its role in various pharmacological applications, including antifungal and antimicrobial activities. The presence of the thiophenyl group may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the compound's alkenyl side chain can contribute to its reactivity and potential for further chemical modifications. Overall, this compound may be of interest in medicinal chemistry and materials science due to its diverse functional groups and potential applications in drug development or as a chemical intermediate.

Formula: C₁₀H₁₁N₃S₂

InChI: InChI=1/C10H11N3S2/c1-3-4-13-9(11-12-10(13)14)8-5-7(2)15-6-8/h3,5-6H,1,4H2,2H3,(H,12,14)

SMILES: C=CCn1c(c2cc(C)sc2)nnc1S

Synonyms:

• 4-Allyl-5-(5-methyl-3-thienyl)-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 5-(5-methyl-3-thienyl)-4-(2-propen-1-yl)-

4-allyl-5-(5-methyl-3-thienyl)-4H-1,2,4-triazole-3-thiol

CAS: 588680-35-7

Formula: C₁₀H₁₁N₃S₂

Purity: 95.0%

Molecular weight: 237.34

Ref: 10-F307679