CAS 588681-52-1

2-[(2-chloro-4-fluorobenzyl)oxy]benzaldehyde

Description:

2-[(2-Chloro-4-fluorobenzyl)oxy]benzaldehyde, with the CAS number 588681-52-1, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and an ether linkage. This compound features a chloro and a fluorine substituent on the benzyl moiety, contributing to its unique chemical properties. The presence of these halogens can influence the compound's reactivity, polarity, and potential biological activity. Typically, compounds like this may exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in organic solvents. The aldehyde group is known for its reactivity, particularly in nucleophilic addition reactions, and can serve as a precursor for various synthetic pathways. Additionally, the compound may have applications in medicinal chemistry or material science, depending on its specific properties and reactivity. Safety and handling considerations should be taken into account, as halogenated compounds can pose environmental and health risks.

Formula: C₁₄H₁₀ClFO₂

InChI: InChI=1/C14H10ClFO2/c15-13-7-12(16)6-5-11(13)9-18-14-4-2-1-3-10(14)8-17/h1-8H,9H2

SMILES: c1ccc(c(c1)C=O)OCc1ccc(cc1Cl)F

Synonyms:

• Benzaldehyde, 2-[(2-Chloro-4-Fluorophenyl)Methoxy]-

2-[(2-chloro-4-fluorobenzyl)oxy]benzaldehyde

CAS: 588681-52-1

Formula: C₁₄H₁₀ClFO₂

Purity: 95.0%

Molecular weight: 264.68

Ref: 10-F307544