CAS 588681-98-5

2-(4-Bromo-2-chlorophenoxy)-2-methylpropanoic acid

Description:

2-(4-Bromo-2-chlorophenoxy)-2-methylpropanoic acid, with the CAS number 588681-98-5, is a chemical compound characterized by its unique structure, which includes a phenoxy group substituted with bromine and chlorine atoms. This compound typically exhibits properties associated with both acidic and aromatic functionalities. The presence of the carboxylic acid group (-COOH) contributes to its acidic nature, while the halogen substituents can influence its reactivity and solubility in various solvents. The compound may be used in research and development, particularly in the fields of agrochemicals or pharmaceuticals, due to its potential biological activity. Its molecular structure suggests that it may interact with biological systems, possibly affecting enzyme activity or cellular processes. Additionally, the presence of halogens can enhance the compound's stability and alter its lipophilicity, which may be relevant for its application in drug design or environmental studies. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₀H₁₀BrClO₃

InChI: InChI=1S/C10H10BrClO3/c1-10(2,9(13)14)15-8-4-3-6(11)5-7(8)12/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=MVGAVLUYDJOUEP-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)(C)C)C1=C(Cl)C=C(Br)C=C1

Synonyms:

• 2-(4-Bromo-2-chloro-phenoxy)-2-methyl-propionic acid
• Propanoic Acid, 2-(4-Bromo-2-Chlorophenoxy)-2-Methyl-
• 2-(4-Bromo-2-chlorophenoxy)-2-methylpropanoic acid

2-(4-bromo-2-chlorophenoxy)-2-methylpropanoic acid

CAS: 588681-98-5

Formula: C₁₀H₁₀BrClO₃

Purity: 95.0%

Molecular weight: 293.54

Ref: 10-F307519