CAS 588685-90-9

4-methyl-5-(5-methylthiophen-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-(5-methylthiophen-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of methyl and thiophenyl substituents enhances its lipophilicity and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, agrochemicals, or as a research tool in various biochemical assays. Its unique structural features may confer specific properties such as solubility, stability, and biological activity, making it a subject of study in drug development and material science. As with many organic compounds, its behavior in different environments, including solubility in various solvents and stability under different conditions, would be critical for its practical applications.

Formula: C₈H₉N₃S₂

InChI: InChI=1/C8H9N3S2/c1-5-3-6(4-13-5)7-9-10-8(12)11(7)2/h3-4H,1-2H3,(H,10,12)

SMILES: Cc1cc(cs1)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-methyl-5-(5-methyl-3-thienyl)-
• 4-Methyl-5-(5-methyl-3-thienyl)-4H-1,2,4-triazole-3-thiol

4-methyl-5-(5-methyl-3-thienyl)-4H-1,2,4-triazole-3-thiol

CAS: 588685-90-9

Formula: C₈H₉N₃S₂

Purity: 95.0%

Molecular weight: 211.3

Ref: 10-F307677