CAS 588685-93-2

5-(4,5-dimethylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(4,5-dimethylthiophen-3-yl)-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structure, which includes a triazole ring and a thiophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the thiol group (thione) suggests it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its molecular structure allows for potential interactions with biological targets, which may lead to applications in drug development. Additionally, the presence of multiple methyl groups contributes to its lipophilicity, influencing its pharmacokinetic properties. Overall, this compound represents a class of heterocyclic compounds that may possess significant therapeutic potential, warranting further investigation into its biological effects and mechanisms of action.

Formula: C₉H₁₁N₃S₂

InChI: InChI=1/C9H11N3S2/c1-5-6(2)14-4-7(5)8-10-11-9(13)12(8)3/h4H,1-3H3,(H,11,13)

SMILES: Cc1c(C)scc1c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(4,5-dimethyl-3-thienyl)-4-methyl-
• 5-(4,5-Dimethyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

5-(4,5-Dimethylthien-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588685-93-2

Formula: C₉H₁₁N₃S₂

Molecular weight: 225.3337

Ref: IN-DA00EEAS

5-(4,5-dimethyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588685-93-2

Formula: C₉H₁₁N₃S₂

Purity: 95.0%

Molecular weight: 225.33

Ref: 10-F307685