CAS 588687-48-3

4-methyl-5-[5-(1-methylethyl)thiophen-3-yl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-[5-(1-methylethyl)thiophen-3-yl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structure, which includes a triazole ring and a thiophene moiety. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) on the thiophene ring enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. The methyl group on the triazole ring may also affect its electronic properties and stability. Compounds of this nature are often investigated for their pharmacological properties, including antimicrobial and antifungal activities, due to the presence of sulfur and nitrogen in their structure, which can play significant roles in biological interactions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and agrochemicals.

Formula: C₁₀H₁₃N₃S₂

InChI: InChI=1/C10H13N3S2/c1-6(2)8-4-7(5-15-8)9-11-12-10(14)13(9)3/h4-6H,1-3H3,(H,12,14)

SMILES: CC(C)c1cc(cs1)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-methyl-5-[5-(1-methylethyl)-3-thienyl]-
• 5-(5-Isopropyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

5-(5-Isopropylthien-3-yl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588687-48-3

Formula: C₁₀H₁₃N₃S₂

Molecular weight: 239.3603

Ref: IN-DA00EZB7

5-(5-isopropyl-3-thienyl)-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 588687-48-3

Formula: C₁₀H₁₃N₃S₂

Purity: 95.0%

Molecular weight: 239.36

Ref: 10-F307684