CAS 588687-53-0

4-methyl-5-(5-propylthiophen-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-(5-propylthiophen-3-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features a methyl group and a propylthiophenyl substituent, contributing to its diverse chemical properties and potential biological activities. The presence of the thione functional group (–C=S) indicates that it may exhibit thioketone-like reactivity, which can influence its interactions in various chemical environments. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the triazole moiety, which is known for its antifungal properties. Additionally, the presence of sulfur in the thiophenyl group may enhance its reactivity and solubility in organic solvents. Overall, this compound's unique structural features make it a subject of interest for further research in medicinal chemistry and material science.

Formula: C₁₀H₁₃N₃S₂

InChI: InChI=1/C10H13N3S2/c1-3-4-8-5-7(6-15-8)9-11-12-10(14)13(9)2/h5-6H,3-4H2,1-2H3,(H,12,14)

SMILES: CCCc1cc(cs1)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-methyl-5-(5-propyl-3-thienyl)-
• 4-Methyl-5-(5-propyl-3-thienyl)-4H-1,2,4-triazole-3-thiol

4-methyl-5-(5-propyl-3-thienyl)-4H-1,2,4-triazole-3-thiol

CAS: 588687-53-0

Formula: C₁₀H₁₃N₃S₂

Purity: 95.0%

Molecular weight: 239.36

Ref: 10-F307683