CAS 58869-89-9
:Octahydro-4(1H)-quinolinone
Description:
Octahydro-4(1H)-quinolinone, with the CAS number 58869-89-9, is a bicyclic organic compound characterized by its saturated ring structure. It features a quinolinone framework, which is a derivative of quinoline, and is notable for its nitrogen-containing heterocycle. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents and exhibits moderate stability under standard conditions. Octahydro-4(1H)-quinolinone is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in the synthesis of pharmaceuticals. Its structure allows for various functionalizations, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit properties such as mild toxicity and should be handled with appropriate safety precautions in laboratory settings. Overall, Octahydro-4(1H)-quinolinone represents a significant compound in the study of heterocyclic chemistry and its applications in drug development.
Formula:C9H15NO
InChI:InChI=1/C9H15NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h7-8,10H,1-6H2
SMILES:C1CCC2C(C1)C(=O)CCN2
Synonyms:- 4(1H)-quinolinone, octahydro-
- octahydroquinolin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Octahydro-quinolin-4-one hydrochloride
CAS:Formula:C9H16ClNOColor and Shape:No data available.Molecular weight:189.68

