CAS 588692-06-2

5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structure, which includes a triazole ring and a thione functional group. This compound features a chloro-substituted aromatic moiety, contributing to its potential biological activity. The presence of the ethyl and phenoxy groups enhances its lipophilicity, which may influence its solubility and permeability in biological systems. As a triazole derivative, it may exhibit properties relevant to agricultural applications, particularly as a fungicide or herbicide, due to the triazole's known role in inhibiting sterol biosynthesis in fungi. The thione group may also impart specific reactivity, potentially allowing for interactions with various biological targets. Overall, this compound's characteristics suggest it could be of interest in medicinal chemistry and agricultural science, although specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₁₃H₁₆ClN₃OS

InChI: InChI=1/C13H16ClN3OS/c1-4-17-12(15-16-13(17)19)9(3)18-11-7-8(2)5-6-10(11)14/h5-7,9H,4H2,1-3H3,(H,16,19)

SMILES: CCn1c(C(C)Oc2cc(C)ccc2Cl)nnc1S

5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 588692-06-2

Formula: C₁₃H₁₆ClN₃OS

Purity: 95.0%

Molecular weight: 297.8

Ref: 10-F307790