CAS 588692-37-9
:2-Amino-N-(2-furanylmethyl)-5-methyl-4-phenyl-3-thiophenecarboxamide
Description:
2-Amino-N-(2-furanylmethyl)-5-methyl-4-phenyl-3-thiophenecarboxamide, with the CAS number 588692-37-9, is a synthetic organic compound characterized by its complex structure, which includes an amino group, a furan moiety, and a thiophene ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of functional groups that can participate in various chemical reactions. The furan and thiophene rings contribute to its aromatic character, which may influence its electronic properties and reactivity. Additionally, the presence of the carboxamide group suggests potential for hydrogen bonding, which can affect its interactions in biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C17H16N2O2S
InChI:InChI=1S/C17H16N2O2S/c1-11-14(12-6-3-2-4-7-12)15(16(18)22-11)17(20)19-10-13-8-5-9-21-13/h2-9H,10,18H2,1H3,(H,19,20)
InChI key:InChIKey=JTZVWQORXVTWGU-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)(=O)C=2C(=C(C)SC2N)C3=CC=CC=C3
Synonyms:- 3-Thiophenecarboxamide, 2-amino-N-(2-furanylmethyl)-5-methyl-4-phenyl-
- 2-Amino-N-(2-furanylmethyl)-5-methyl-4-phenyl-3-thiophenecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.