CAS 588696-82-6

7-chloro-8-methyl-2-pyridin-2-ylquinoline-4-carboxylic acid

Description:

7-Chloro-8-methyl-2-pyridin-2-ylquinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group, a methyl group, and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, influencing its interactions in biological systems. The presence of chlorine and methyl groups can affect the compound's lipophilicity and overall pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit biological activity, potentially serving as a lead compound in drug discovery or as a tool in biochemical research. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with biological targets.

Formula: C₁₆H₁₁ClN₂O₂

InChI: InChI=1/C16H11ClN2O2/c1-9-12(17)6-5-10-11(16(20)21)8-14(19-15(9)10)13-4-2-3-7-18-13/h2-8H,1H3,(H,20,21)

SMILES: Cc1c(ccc2c(cc(c3ccccn3)nc12)C(=O)O)Cl

Synonyms:

• 4-Quinolinecarboxylic Acid, 7-Chloro-8-Methyl-2-(2-Pyridinyl)-

7-chloro-8-methyl-2-pyridin-2-ylquinoline-4-carboxylic acid

CAS: 588696-82-6

Purity: 95.0%

Molecular weight: 298.7300109863281

Ref: 10-F307485