CAS 588696-83-7

7-chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid

Description:

7-Chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core fused with a pyridine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of chlorine and methyl substituents on the quinoline ring enhances its reactivity and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological activities, including antimicrobial and anticancer properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its CAS number, 588696-83-7, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a unique scaffold for further exploration in drug discovery and development.

Formula: C₁₆H₁₁ClN₂O₂

InChI: InChI=1/C16H11ClN2O2/c1-9-13(17)5-4-11-12(16(20)21)7-14(19-15(9)11)10-3-2-6-18-8-10/h2-8H,1H3,(H,20,21)

SMILES: Cc1c(ccc2c(cc(c3cccnc3)nc12)C(=O)O)Cl

Synonyms:

• 4-Quinolinecarboxylic Acid, 7-Chloro-8-Methyl-2-(3-Pyridinyl)-

7-chloro-8-methyl-2-pyridin-3-ylquinoline-4-carboxylic acid

CAS: 588696-83-7

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 298.7300109863281

Ref: 10-F307482