CAS 588696-85-9

7-Chloro-8-methyl-2-(4-pyridinyl)-4-quinolinecarboxylic acid

Description:

7-Chloro-8-methyl-2-(4-pyridinyl)-4-quinolinecarboxylic acid, with the CAS number 588696-85-9, is a chemical compound that belongs to the class of quinoline derivatives. This substance is characterized by its complex structure, which includes a quinoline core substituted with a chloro group at the 7-position, a methyl group at the 8-position, and a pyridine ring at the 2-position. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The carboxylic acid functional group at the 4-position enhances its solubility and reactivity, allowing for various chemical modifications. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its unique structural features and potential applications make it a subject of interest in research, particularly in the fields of pharmacology and organic synthesis.

Formula: C₁₆H₁₁ClN₂O₂

InChI: InChI=1S/C16H11ClN2O2/c1-9-13(17)3-2-11-12(16(20)21)8-14(19-15(9)11)10-4-6-18-7-5-10/h2-8H,1H3,(H,20,21)

InChI key: InChIKey=CFKNJONHEVWXHA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C=3C=CN=CC3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarboxylic Acid, 7-Chloro-8-Methyl-2-(4-Pyridinyl)-
• 7-Chloro-8-methyl-2-(4-pyridinyl)-4-quinolinecarboxylic acid

7-chloro-8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid

CAS: 588696-85-9

Purity: 95.0%

Molecular weight: 298.7300109863281

Ref: 10-F307478