CAS 58871-11-7
:4-O-benzyl-D-glucal
Description:
4-O-benzyl-D-glucal is a carbohydrate derivative characterized by its structure, which includes a glucal moiety with a benzyl group attached at the 4-position of the glucose ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as methanol and dichloromethane, while being less soluble in water due to its hydrophobic benzyl substituent. The presence of the benzyl group enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in glycosylation reactions. Additionally, 4-O-benzyl-D-glucal can participate in various chemical transformations, including oxidation and reduction, which can be exploited in the synthesis of more complex carbohydrates or glycosides. Its unique structural features also make it a subject of interest in the study of carbohydrate chemistry and its applications in medicinal chemistry, where modifications of sugar structures can lead to novel therapeutic agents. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C13H16O4
InChI:InChI=1/C13H16O4/c14-8-12-13(11(15)6-7-16-12)17-9-10-4-2-1-3-5-10/h1-7,11-15H,8-9H2/t11-,12-,13+/m1/s1
Synonyms:- 1,5-anhydro-4-O-benzyl-2-deoxy-D-arabino-hex-1-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-O-Benzyl-D-glucal, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C13H16O4Purity:97%Molecular weight:236.264-O-Benzyl-D-glucal
CAS:4-O-Benzyl-D-glucal is an organic solvent and a reactive intermediate, which has been used as a reagent for allylic oxidation. It reacts with halogens, such as chlorine or bromine, to form the corresponding halohydrin or halonium salt in high yield. 4-O-Benzyl-D-glucal is soluble in acetonitrile, benzene, and other solvents and can be used as a solvent for organic synthesis. The compound also reacts with oxygen to form solvents such as acetone or acetic acid. END>Formula:C13H16O4Purity:Min. 95%Molecular weight:236.26 g/mol



