CAS 588720-12-1

ethyl 6-bromopyrrolo[1,2-c]pyrimidine-3-carboxylate

Description:

Ethyl 6-bromopyrrolo[1,2-c]pyrimidine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a bromine atom at the 6-position of the pyrrolo ring, contributing to its reactivity and potential biological activity. The ethyl ester functional group at the carboxylate position enhances its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the carboxylate group also suggests potential for further chemical modifications, which can be exploited in medicinal chemistry. This compound may exhibit interesting pharmacological properties, as many derivatives of pyrrolo[1,2-c]pyrimidines are known for their activity against various biological targets. Its molecular structure allows for potential interactions with enzymes or receptors, making it a candidate for drug development. Overall, ethyl 6-bromopyrrolo[1,2-c]pyrimidine-3-carboxylate is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₀H₉BrN₂O₂

InChI: InChI=1/C10H9BrN2O2/c1-2-15-10(14)9-4-8-3-7(11)5-13(8)6-12-9/h3-6H,2H2,1H3

SMILES: CCOC(=O)c1cc2cc(cn2cn1)Br

Synonyms:

• Ethyl 6-bromopyrrolo[1,2-c]pyrimidine-3-carboxylate

ethyl 6-bromoH-pyrrolo[1,2-f]pyrimidine-3-carboxylate

CAS: 588720-12-1

Formula: C₁₀H₉BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 269.0947

Ref: IN-DA00E9P9

Ethyl 6-bromo-1,2-dihydropyrrolo[1,2-c]pyrimidine-3-carboxylate

CAS: 588720-12-1

Ethyl 6-bromo-1,2-dihydropyrrolo[1,2-c]pyrimidine-3-carboxylate

Purity: 98%

Molecular weight: 269.1g/mol

Ref: 54-OR1031891

ETHYL 6-BROMOPYRROLO[1,2-C]PYRIMIDINE-3-CARBOXYLATE

CAS: 588720-12-1

Purity: 98%

Molecular weight: 269.0979919

Ref: 10-F795186