CAS 588720-42-7

indolizine-6-carboxylic acid

Description:

Indolizine-6-carboxylic acid is a heterocyclic organic compound characterized by its indolizine core structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 6-position of the indolizine ring, contributing to its acidic properties. Indolizine derivatives are known for their diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate interactions with biological targets. Additionally, indolizine-6-carboxylic acid may exhibit interesting optical and electronic properties, making it a subject of interest in materials science and organic electronics. Its synthesis typically involves multi-step organic reactions, and its reactivity can be influenced by the substituents on the indolizine ring. Overall, indolizine-6-carboxylic acid represents a valuable compound in both synthetic organic chemistry and medicinal chemistry research.

Formula: C₉H₇NO₂

InChI: InChI=1/C9H7NO2/c11-9(12)7-3-4-8-2-1-5-10(8)6-7/h1-6H,(H,11,12)

SMILES: c1cc2ccc(cn2c1)C(=O)O

Synonyms:

• 6-Indolizinecarboxylic Acid

Indolizine-6-carboxylic acid

CAS: 588720-42-7

Indolizine-6-carboxylic acid is a versatile compound that has various applications in research and industry. It is commonly used as a reagent in organic synthesis and as a starting material for the production of other chemicals. Indolizine-6-carboxylic acid can be synthesized from methanol and lithocholic acid, making it an important compound in the field of research chemicals. It is also used in the industrial production of herbicides and biomass. Additionally, indolizine-6-carboxylic acid has been found to have potential therapeutic properties, such as anti-cancer activity. Overall, this compound plays a crucial role in many scientific and industrial processes.

Formula: C₉H₇NO₂

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-NYA72042