CymitQuimica logo

CAS 588720-62-1

:

ethyl 6-bromopyrrolo[1,2-a]pyrazine-3-carboxylate

Description:
Ethyl 6-bromopyrrolo[1,2-a]pyrazine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyrazine moiety. This compound features a bromine atom at the 6-position of the pyrrole ring, contributing to its reactivity and potential applications in medicinal chemistry. The ethyl ester functional group at the carboxylate position enhances its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the carboxylate group also suggests potential for further functionalization, which can be exploited in drug development or material science. Additionally, the compound's structural features may impart specific biological activities, making it of interest in pharmacological research. Its CAS number, 588720-62-1, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in scientific literature. Overall, ethyl 6-bromopyrrolo[1,2-a]pyrazine-3-carboxylate represents a versatile scaffold for further exploration in chemical synthesis and biological activity.
Formula:C10H9BrN2O2
InChI:InChI=1/C10H9BrN2O2/c1-2-15-10(14)8-6-13-7(5-12-8)3-4-9(13)11/h3-6H,2H2,1H3
SMILES:CCOC(=O)c1cn2c(ccc2Br)cn1
Synonyms:
  • Ethyl 6-bromopyrrolo[1,2-a]pyrazine-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.