CAS 588729-99-1
:2-Chloro-3-amino-5-bromopyridine
Description:
2-Chloro-3-amino-5-bromopyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of chlorine and bromine substituents at the 2 and 5 positions, respectively, along with an amino group at the 3 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits basic properties due to the amino group, which can participate in hydrogen bonding and nucleophilic reactions. The halogen substituents can influence its reactivity, making it a potential candidate for various chemical transformations, including cross-coupling reactions and as a building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound's structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C5H4BrClN2
InChI:InChI=1/C5H4BrClN2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2
Synonyms:- 3-Amino-5-bromo-2-chloropyridine
- 5-Bromo-2-chloropyridin-3-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Amino-5-bromo-2-chloropyridine
CAS:Formula:C5H4BrClN2Purity:97%Color and Shape:SolidMolecular weight:207.45573-Amino-5-bromo-2-chloropyridine
CAS:3-Amino-5-bromo-2-chloropyridineFormula:C5H4BrClN2Purity:98%Color and Shape: dark brown crystalline solidMolecular weight:207.46g/mol3-Amino-5-bromo-2-chloropyridine
CAS:Formula:C5H4BrClN2Purity:97%Color and Shape:SolidMolecular weight:207.463-Amino-5-bromo-2-chloropyridine
CAS:Formula:C5H4BrClN2Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:207.463-Amino-5-bromo-2-chloropyridine
CAS:3-Amino-5-bromo-2-chloropyridine is a synthetic compound that has been shown to be an inhibitor of phosphoinositide 3 kinase delta (PI3Kδ). It is also a potent inhibitor of the proliferation of human cancer cells in vitro and in vivo. The PI3Kδ is activated by insulin and other growth factors, which leads to the activation of downstream pathways. These pathways trigger cell growth and proliferation. 3-Amino-5-bromo-2-chloropyridine may have potential as a novel anticancer drug due to its ability to inhibit PI3Kδ activity and prevent the progression of cancer.Formula:C5H4BrClN2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:207.46 g/mol





