CAS 588732-72-3

2,3-dihydrofuro[2,3-c]pyridin-7(6H)-one

Description:

2,3-Dihydrofuro[2,3-c]pyridin-7(6H)-one is a heterocyclic compound characterized by its fused ring structure, which includes both a pyridine and a furan moiety. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating nitrogen and oxygen atoms alongside carbon and hydrogen. It is known for its potential biological activity, which may include antimicrobial or anticancer properties, making it of interest in medicinal chemistry. The presence of the dihydrofuro group contributes to its reactivity and stability, influencing its interactions in various chemical environments. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Its unique structure and properties make it a valuable subject of study in organic synthesis and drug development. As with many heterocycles, the compound's behavior can be influenced by substituents and the overall electronic environment, which is crucial for its applications in pharmaceuticals and material science.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c9-7-6-5(1-3-8-7)2-4-10-6/h1,3H,2,4H2,(H,8,9)

SMILES: c1cnc(c2c1CCO2)O

Synonyms:

• 2,3-Dihydro-6H-furo[2,3-c]pyridin-7-one

2,3-Dihydro-6H-furo[2,3-c]pyridin-7-one

CAS: 588732-72-3

2,3-Dihydro-6H-furo[2,3-c]pyridin-7-one

Purity: ≥95%

Molecular weight: 137.14g/mol

Ref: 54-OR15999