CAS 58878-18-5

4′-(2,4,6-Trihydroxyphenoxy)[1,1′-biphenyl]-2,2′,4,6,6′-pentol

Description:

4′-(2,4,6-Trihydroxyphenoxy)[1,1′-biphenyl]-2,2′,4,6,6′-pentol, with the CAS number 58878-18-5, is a complex organic compound characterized by its multiple hydroxyl groups, which contribute to its solubility and reactivity. This substance features a biphenyl structure, which consists of two phenyl rings connected by a single bond, and is further substituted with a tri-hydroxyphenoxy group. The presence of five hydroxyl groups in total enhances its potential for hydrogen bonding, making it a candidate for various applications, including as an antioxidant or in polymer chemistry. The compound's structure suggests it may exhibit significant biological activity, potentially influencing its interactions in biochemical systems. Its physical properties, such as melting point, boiling point, and solubility, would be influenced by the hydroxyl groups, which typically increase polarity. Additionally, the compound's stability and reactivity can be affected by the arrangement of its functional groups, making it an interesting subject for further research in both synthetic and applied chemistry contexts.

Formula: C₁₈H₁₄O₉

InChI: InChI=1S/C18H14O9/c19-7-1-10(21)16(11(22)2-7)17-12(23)5-9(6-13(17)24)27-18-14(25)3-8(20)4-15(18)26/h1-6,19-26H

InChI key: InChIKey=LXRUQARQPSVVEX-UHFFFAOYSA-N

SMILES: OC1=C(C(O)=CC(OC2=C(O)C=C(O)C=C2O)=C1)C3=C(O)C=C(O)C=C3O

Synonyms:

• Fucophlorethol A
• 2,2′,4,6,6′-Pentahydroxy-4′-(2,4,6-trihydroxyphenoxy)biphenyl
• [1,1′-Biphenyl]-2,2′,4,6,6′-pentol, 4′-(2,4,6-trihydroxyphenoxy)-
• 4′-(2,4,6-Trihydroxyphenoxy)[1,1′-biphenyl]-2,2′,4,6,6′-pentol

Phenol Related Compound 3

CAS: 58878-18-5

Formula: C₁₈H₁₄O₉

Molecular weight: 374.301

Ref: 4Z-P-5760